C11H13N3O5S — CID 166845008
(E)-3-hydroxy-N-[3-(methylsulfamoyl)phenyl]-2-nitrosobut-2-enamide (PubChem CID 166845008) has the molecular formula C11H13N3O5S and a molecular weight of 299.31 g/mol. Its IUPAC name is (E)-3-hydroxy-N-[3-(methylsulfamoyl)phenyl]-2-nitrosobut-2-enamide.
| Compound Name | (E)-3-hydroxy-N-[3-(methylsulfamoyl)phenyl]-2-nitrosobut-2-enamide |
|---|---|
| PubChem CID | 166845008 |
| Molecular Formula | C11H13N3O5S |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (E)-3-hydroxy-N-[3-(methylsulfamoyl)phenyl]-2-nitrosobut-2-enamide |
| SMILES | CNS(=O)(=O)c1cccc(NC(=O)/C(N=O)=C(/C)O)c1 |
| InChI | InChI=1S/C11H13N3O5S/c1-7(15)10(14-17)11(16)13-8-4-3-5-9(6-8)20(18,19)12-2/h3-6,12,15H,1-2H3,(H,13,16)/b10-7+ |
| InChIKey | KBDAUYFBNUJCGX-JXMROGBWSA-N |
| XLogP | 1.09 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|