C38H48F2N3O6P — CID 166845011
dibutyl [4-[[3-(1,1-difluoropropyl)phenyl]carbamoyl]-2-[3-(2,6-dimethylphenyl)-4-methoxyphenyl]-5-methylimidazol-1-yl]methyl phosphate (PubChem CID 166845011) has the molecular formula C38H48F2N3O6P and a molecular weight of 711.79 g/mol. Its IUPAC name is dibutyl [4-[[3-(1,1-difluoropropyl)phenyl]carbamoyl]-2-[3-(2,6-dimethylphenyl)-4-methoxyphenyl]-5-methylimidazol-1-yl]methyl phosphate.
| Compound Name | dibutyl [4-[[3-(1,1-difluoropropyl)phenyl]carbamoyl]-2-[3-(2,6-dimethylphenyl)-4-methoxyphenyl]-5-methylimidazol-1-yl]methyl phosphate |
|---|---|
| PubChem CID | 166845011 |
| Molecular Formula | C38H48F2N3O6P |
| Molecular Weight | 711.79 g/mol |
| Exact Mass | 711.32 |
| IUPAC Name | dibutyl [4-[[3-(1,1-difluoropropyl)phenyl]carbamoyl]-2-[3-(2,6-dimethylphenyl)-4-methoxyphenyl]-5-methylimidazol-1-yl]methyl phosphate |
| SMILES | CCCCOP(=O)(OCCCC)OCn1c(-c2ccc(OC)c(-c3c(C)cccc3C)c2)nc(C(=O)Nc2cccc(C(F)(F)CC)c2)c1C |
| InChI | InChI=1S/C38H48F2N3O6P/c1-8-11-21-47-50(45,48-22-12-9-2)49-25-43-28(6)35(37(44)41-31-18-14-17-30(24-31)38(39,40)10-3)42-36(43)29-19-20-33(46-7)32(23-29)34-26(4)15-13-16-27(34)5/h13-20,23-24H,8-12,21-22,25H2,1-7H3,(H,41,44) |
| InChIKey | DJDLHTCWSWLYDC-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.79 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|