C32H31F2N3O3 — CID 167525243
N-[3-(1,1-difluoropropyl)phenyl]-2-[3-(2,6-dimethyl-4-prop-1-ynylphenyl)-4-methoxyphenyl]-3-hydroxy-5-methylimidazole-4-carboxamide (PubChem CID 167525243) has the molecular formula C32H31F2N3O3 and a molecular weight of 543.61 g/mol. Its IUPAC name is N-[3-(1,1-difluoropropyl)phenyl]-2-[3-(2,6-dimethyl-4-prop-1-ynylphenyl)-4-methoxyphenyl]-3-hydroxy-5-methylimidazole-4-carboxamide.
| Compound Name | N-[3-(1,1-difluoropropyl)phenyl]-2-[3-(2,6-dimethyl-4-prop-1-ynylphenyl)-4-methoxyphenyl]-3-hydroxy-5-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 167525243 |
| Molecular Formula | C32H31F2N3O3 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | N-[3-(1,1-difluoropropyl)phenyl]-2-[3-(2,6-dimethyl-4-prop-1-ynylphenyl)-4-methoxyphenyl]-3-hydroxy-5-methylimidazole-4-carboxamide |
| SMILES | CC#Cc1cc(C)c(-c2cc(-c3nc(C)c(C(=O)Nc4cccc(C(F)(F)CC)c4)n3O)ccc2OC)c(C)c1 |
| InChI | InChI=1S/C32H31F2N3O3/c1-7-10-22-15-19(3)28(20(4)16-22)26-17-23(13-14-27(26)40-6)30-35-21(5)29(37(30)39)31(38)36-25-12-9-11-24(18-25)32(33,34)8-2/h9,11-18,39H,8H2,1-6H3,(H,36,38) |
| InChIKey | HUASSNTVKQPEOP-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|