C30H35F2N3O3 — CID 166844837
(Z)-N-[3-(1,1-difluoropropyl)phenyl]-2-(hydroxyamino)-3-[[4-methoxy-3-(2,4,6-trimethylphenyl)phenyl]methylamino]but-2-enamide (PubChem CID 166844837) has the molecular formula C30H35F2N3O3 and a molecular weight of 523.62 g/mol. Its IUPAC name is (Z)-N-[3-(1,1-difluoropropyl)phenyl]-2-(hydroxyamino)-3-[[4-methoxy-3-(2,4,6-trimethylphenyl)phenyl]methylamino]but-2-enamide.
| Compound Name | (Z)-N-[3-(1,1-difluoropropyl)phenyl]-2-(hydroxyamino)-3-[[4-methoxy-3-(2,4,6-trimethylphenyl)phenyl]methylamino]but-2-enamide |
|---|---|
| PubChem CID | 166844837 |
| Molecular Formula | C30H35F2N3O3 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | (Z)-N-[3-(1,1-difluoropropyl)phenyl]-2-(hydroxyamino)-3-[[4-methoxy-3-(2,4,6-trimethylphenyl)phenyl]methylamino]but-2-enamide |
| SMILES | CCC(F)(F)c1cccc(NC(=O)/C(NO)=C(\C)NCc2ccc(OC)c(-c3c(C)cc(C)cc3C)c2)c1 |
| InChI | InChI=1S/C30H35F2N3O3/c1-7-30(31,32)23-9-8-10-24(16-23)34-29(36)28(35-37)21(5)33-17-22-11-12-26(38-6)25(15-22)27-19(3)13-18(2)14-20(27)4/h8-16,33,35,37H,7,17H2,1-6H3,(H,34,36)/b28-21- |
| InChIKey | NLGKUZJVNWGXMJ-HFTWOUSFSA-N |
| XLogP | 6.73 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|