C11H15F7O3 — CID 166847003
4-[2,2,3,3-tetrafluoro-4-(3,3,3-trifluoropropoxy)cyclobutyl]oxybutan-1-ol (PubChem CID 166847003) has the molecular formula C11H15F7O3 and a molecular weight of 328.22 g/mol. Its IUPAC name is 4-[2,2,3,3-tetrafluoro-4-(3,3,3-trifluoropropoxy)cyclobutyl]oxybutan-1-ol.
| Compound Name | 4-[2,2,3,3-tetrafluoro-4-(3,3,3-trifluoropropoxy)cyclobutyl]oxybutan-1-ol |
|---|---|
| PubChem CID | 166847003 |
| Molecular Formula | C11H15F7O3 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-[2,2,3,3-tetrafluoro-4-(3,3,3-trifluoropropoxy)cyclobutyl]oxybutan-1-ol |
| SMILES | OCCCCOC1C(OCCC(F)(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H15F7O3/c12-9(13,14)3-6-21-8-7(20-5-2-1-4-19)10(15,16)11(8,17)18/h7-8,19H,1-6H2 |
| InChIKey | AQNKMLUGKKVSCR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|