C16H21NO4 — CID 166853142
benzyl 2-[3-(dihydroxymethyl)-4-ethyl-2,5-dihydropyrrol-1-yl]acetate (PubChem CID 166853142) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl 2-[3-(dihydroxymethyl)-4-ethyl-2,5-dihydropyrrol-1-yl]acetate.
| Compound Name | benzyl 2-[3-(dihydroxymethyl)-4-ethyl-2,5-dihydropyrrol-1-yl]acetate |
|---|---|
| PubChem CID | 166853142 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | benzyl 2-[3-(dihydroxymethyl)-4-ethyl-2,5-dihydropyrrol-1-yl]acetate |
| SMILES | CCC1=C(C(O)O)CN(CC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H21NO4/c1-2-13-8-17(9-14(13)16(19)20)10-15(18)21-11-12-6-4-3-5-7-12/h3-7,16,19-20H,2,8-11H2,1H3 |
| InChIKey | FIUSPXXEGHPCKH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|