C27H35N3O5 — CID 166853643
(1S)-3-[4-[(E)-3-[amino(methyl)amino]-4-[methyl(phenylmethoxycarbonyl)amino]but-2-en-2-yl]phenoxy]cyclohexane-1-carboxylic acid (PubChem CID 166853643) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is (1S)-3-[4-[(E)-3-[amino(methyl)amino]-4-[methyl(phenylmethoxycarbonyl)amino]but-2-en-2-yl]phenoxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1S)-3-[4-[(E)-3-[amino(methyl)amino]-4-[methyl(phenylmethoxycarbonyl)amino]but-2-en-2-yl]phenoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166853643 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (1S)-3-[4-[(E)-3-[amino(methyl)amino]-4-[methyl(phenylmethoxycarbonyl)amino]but-2-en-2-yl]phenoxy]cyclohexane-1-carboxylic acid |
| SMILES | C/C(=C(/CN(C)C(=O)OCc1ccccc1)N(C)N)c1ccc(OC2CCC[C@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C27H35N3O5/c1-19(21-12-14-23(15-13-21)35-24-11-7-10-22(16-24)26(31)32)25(30(3)28)17-29(2)27(33)34-18-20-8-5-4-6-9-20/h4-6,8-9,12-15,22,24H,7,10-11,16-18,28H2,1-3H3,(H,31,32)/b25-19+/t22-,24?/m0/s1 |
| InChIKey | SQHSLJQQLAYSQH-OLWZJACVSA-N |
| XLogP | 4.51 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|