C24H32N4O3 — CID 166853599
[(Z)-2-amino-3-(N-amino-4-cyclohexyloxyanilino)prop-2-enyl] N-benzyl-N-methylcarbamate (PubChem CID 166853599) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is [(Z)-2-amino-3-(N-amino-4-cyclohexyloxyanilino)prop-2-enyl] N-benzyl-N-methylcarbamate.
| Compound Name | [(Z)-2-amino-3-(N-amino-4-cyclohexyloxyanilino)prop-2-enyl] N-benzyl-N-methylcarbamate |
|---|---|
| PubChem CID | 166853599 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [(Z)-2-amino-3-(N-amino-4-cyclohexyloxyanilino)prop-2-enyl] N-benzyl-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1)C(=O)OC/C(N)=C/N(N)c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-27(16-19-8-4-2-5-9-19)24(29)30-18-20(25)17-28(26)21-12-14-23(15-13-21)31-22-10-6-3-7-11-22/h2,4-5,8-9,12-15,17,22H,3,6-7,10-11,16,18,25-26H2,1H3/b20-17- |
| InChIKey | AUCQNTKKHXWMOE-JZJYNLBNSA-N |
| XLogP | 4.15 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|