C23H39N5O3 — CID 145423871
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-(cyclopropylmethyl)-N-methylcarbamate;ethane (PubChem CID 145423871) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-(cyclopropylmethyl)-N-methylcarbamate;ethane.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-(cyclopropylmethyl)-N-methylcarbamate;ethane |
|---|---|
| PubChem CID | 145423871 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-(cyclopropylmethyl)-N-methylcarbamate;ethane |
| SMILES | CC.CN(CC1CC1)C(=O)OC/C(=C(/N)c1ccc(OC2CCCCC2)cn1)N(C)N |
| InChI | InChI=1S/C21H33N5O3.C2H6/c1-25(13-15-8-9-15)21(27)28-14-19(26(2)23)20(22)18-11-10-17(12-24-18)29-16-6-4-3-5-7-16;1-2/h10-12,15-16H,3-9,13-14,22-23H2,1-2H3;1-2H3/b20-19-; |
| InChIKey | SDODLGYBOAUHKD-BLTQDSCZSA-N |
| XLogP | 3.73 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|