C23H35N5O3 — CID 145423885
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-spiro[2.3]hexan-5-ylcarbamate (PubChem CID 145423885) has the molecular formula C23H35N5O3 and a molecular weight of 429.57 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-spiro[2.3]hexan-5-ylcarbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-spiro[2.3]hexan-5-ylcarbamate |
|---|---|
| PubChem CID | 145423885 |
| Molecular Formula | C23H35N5O3 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-spiro[2.3]hexan-5-ylcarbamate |
| SMILES | CN(N)/C(COC(=O)N(C)C1CC2(CC2)C1)=C(\N)c1ccc(OC2CCCCC2)cn1 |
| InChI | InChI=1S/C23H35N5O3/c1-27(16-12-23(13-16)10-11-23)22(29)30-15-20(28(2)25)21(24)19-9-8-18(14-26-19)31-17-6-4-3-5-7-17/h8-9,14,16-17H,3-7,10-13,15,24-25H2,1-2H3/b21-20- |
| InChIKey | YEJDEDWNGHWRGR-MRCUWXFGSA-N |
| XLogP | 3.24 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|