C23H37N5O3 — CID 166804302
(1-propylcyclopropyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 166804302) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is (1-propylcyclopropyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | (1-propylcyclopropyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166804302 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | (1-propylcyclopropyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | CCCC1(COC(=O)NC/C(=C(/N)c2ccc(OC3CCCCC3)cn2)N(C)N)CC1 |
| InChI | InChI=1S/C23H37N5O3/c1-3-11-23(12-13-23)16-30-22(29)27-15-20(28(2)25)21(24)19-10-9-18(14-26-19)31-17-7-5-4-6-8-17/h9-10,14,17H,3-8,11-13,15-16,24-25H2,1-2H3,(H,27,29)/b21-20- |
| InChIKey | LCDZZJRXCWJTNS-MRCUWXFGSA-N |
| XLogP | 3.53 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|