C18H29N5O3 — CID 166804155
methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 166804155) has the molecular formula C18H29N5O3 and a molecular weight of 363.46 g/mol. Its IUPAC name is methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166804155 |
| Molecular Formula | C18H29N5O3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | COC(=O)NC/C(=C(/N)c1ccc(OC2CCCCC2)c(C)n1)N(C)N |
| InChI | InChI=1S/C18H29N5O3/c1-12-16(26-13-7-5-4-6-8-13)10-9-14(22-12)17(19)15(23(2)20)11-21-18(24)25-3/h9-10,13H,4-8,11,19-20H2,1-3H3,(H,21,24)/b17-15- |
| InChIKey | CTTQXAYNACIMJD-ICFOKQHNSA-N |
| XLogP | 1.89 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|