C21H35N5O3 — CID 166804323
butan-2-yl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 166804323) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is butan-2-yl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | butan-2-yl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166804323 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | butan-2-yl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | CCC(C)OC(=O)NC/C(=C(/N)c1ccc(OC2CCCCC2)c(C)n1)N(C)N |
| InChI | InChI=1S/C21H35N5O3/c1-5-14(2)28-21(27)24-13-18(26(4)23)20(22)17-11-12-19(15(3)25-17)29-16-9-7-6-8-10-16/h11-12,14,16H,5-10,13,22-23H2,1-4H3,(H,24,27)/b20-18- |
| InChIKey | TYRAQYXMDMOVPV-ZZEZOPTASA-N |
| XLogP | 3.06 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|