C25H36N6O2 — CID 166804141
3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-benzyl-1-methylurea (PubChem CID 166804141) has the molecular formula C25H36N6O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-benzyl-1-methylurea.
| Compound Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-benzyl-1-methylurea |
|---|---|
| PubChem CID | 166804141 |
| Molecular Formula | C25H36N6O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-benzyl-1-methylurea |
| SMILES | Cc1nc(/C(N)=C(\CNC(=O)N(C)Cc2ccccc2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C25H36N6O2/c1-18-23(33-20-12-8-5-9-13-20)15-14-21(29-18)24(26)22(31(3)27)16-28-25(32)30(2)17-19-10-6-4-7-11-19/h4,6-7,10-11,14-15,20H,5,8-9,12-13,16-17,26-27H2,1-3H3,(H,28,32)/b24-22- |
| InChIKey | MKFTWYSPHBFQJV-GYHWCHFESA-N |
| XLogP | 3.38 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|