C27H39N5O2 — CID 154936062
(Z)-6-amino-5-[amino(methyl)amino]-N-benzyl-6-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N-methylhex-5-enamide (PubChem CID 154936062) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is (Z)-6-amino-5-[amino(methyl)amino]-N-benzyl-6-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N-methylhex-5-enamide.
| Compound Name | (Z)-6-amino-5-[amino(methyl)amino]-N-benzyl-6-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 154936062 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | (Z)-6-amino-5-[amino(methyl)amino]-N-benzyl-6-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N-methylhex-5-enamide |
| SMILES | Cc1nc(/C(N)=C(\CCCC(=O)N(C)Cc2ccccc2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C27H39N5O2/c1-20-25(34-22-13-8-5-9-14-22)18-17-23(30-20)27(28)24(32(3)29)15-10-16-26(33)31(2)19-21-11-6-4-7-12-21/h4,6-7,11-12,17-18,22H,5,8-10,13-16,19,28-29H2,1-3H3/b27-24- |
| InChIKey | ZCPBDIHWIHTIEQ-PNHLSOANSA-N |
| XLogP | 4.36 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|