C25H36N6O3 — CID 167106075
1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3-hydroxycyclohexyl)oxy-6-methyl-2-pyridinyl]prop-2-enyl]-3-benzyl-1-methylurea (PubChem CID 167106075) has the molecular formula C25H36N6O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3-hydroxycyclohexyl)oxy-6-methyl-2-pyridinyl]prop-2-enyl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3-hydroxycyclohexyl)oxy-6-methyl-2-pyridinyl]prop-2-enyl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 167106075 |
| Molecular Formula | C25H36N6O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-(3-hydroxycyclohexyl)oxy-6-methyl-2-pyridinyl]prop-2-enyl]-3-benzyl-1-methylurea |
| SMILES | Cc1nc(/C(N)=C(\CN(C)C(=O)NCc2ccccc2)N(C)N)ccc1OC1CCCC(O)C1 |
| InChI | InChI=1S/C25H36N6O3/c1-17-23(34-20-11-7-10-19(32)14-20)13-12-21(29-17)24(26)22(31(3)27)16-30(2)25(33)28-15-18-8-5-4-6-9-18/h4-6,8-9,12-13,19-20,32H,7,10-11,14-16,26-27H2,1-3H3,(H,28,33)/b24-22- |
| InChIKey | HRVROBSWQVHNSY-GYHWCHFESA-N |
| XLogP | 2.35 |
| TPSA | 129.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|