C25H37N7O — CID 167298322
(Z)-3-[amino-[(Z)-2-amino-3-phenylprop-1-enyl]amino]-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine (PubChem CID 167298322) has the molecular formula C25H37N7O and a molecular weight of 451.62 g/mol. Its IUPAC name is (Z)-3-[amino-[(Z)-2-amino-3-phenylprop-1-enyl]amino]-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine.
| Compound Name | (Z)-3-[amino-[(Z)-2-amino-3-phenylprop-1-enyl]amino]-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298322 |
| Molecular Formula | C25H37N7O |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | (Z)-3-[amino-[(Z)-2-amino-3-phenylprop-1-enyl]amino]-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\CN(N)/C=C(\N)Cc2ccccc2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C25H37N7O/c1-18-24(33-21-11-7-4-8-12-21)14-13-22(30-18)25(27)23(31(2)28)17-32(29)16-20(26)15-19-9-5-3-6-10-19/h3,5-6,9-10,13-14,16,21H,4,7-8,11-12,15,17,26-29H2,1-2H3/b20-16-,25-23- |
| InChIKey | GMIKUQJZXZXXSI-RXKZAILSSA-N |
| XLogP | 2.75 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|