C20H34N8O — CID 167298922
N'-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]cyclopropanecarboximidamide (PubChem CID 167298922) has the molecular formula C20H34N8O and a molecular weight of 402.55 g/mol. Its IUPAC name is N'-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]cyclopropanecarboximidamide.
| Compound Name | N'-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]cyclopropanecarboximidamide |
|---|---|
| PubChem CID | 167298922 |
| Molecular Formula | C20H34N8O |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | N'-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]cyclopropanecarboximidamide |
| SMILES | Cc1nc(/C(N)=C(\CN(N)/N=C(\N)C2CC2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C20H34N8O/c1-13-18(29-15-6-4-3-5-7-15)11-10-16(25-13)19(21)17(27(2)23)12-28(24)26-20(22)14-8-9-14/h10-11,14-15H,3-9,12,21,23-24H2,1-2H3,(H2,22,26)/b19-17- |
| InChIKey | GKPCWGUSAPIZAK-ZPHPHTNESA-N |
| XLogP | 1.39 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|