C23H40N6OS — CID 166804398
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[cyclopentylmethyl(methyl)amino]sulfanylprop-1-ene-1,3-diamine (PubChem CID 166804398) has the molecular formula C23H40N6OS and a molecular weight of 448.68 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[cyclopentylmethyl(methyl)amino]sulfanylprop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[cyclopentylmethyl(methyl)amino]sulfanylprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 166804398 |
| Molecular Formula | C23H40N6OS |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[cyclopentylmethyl(methyl)amino]sulfanylprop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNSN(C)CC2CCCC2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H40N6OS/c1-17-22(30-19-11-5-4-6-12-19)14-13-20(27-17)23(24)21(29(3)25)15-26-31-28(2)16-18-9-7-8-10-18/h13-14,18-19,26H,4-12,15-16,24-25H2,1-3H3/b23-21- |
| InChIKey | KJLHWTMTACRDDT-LNVKXUELSA-N |
| XLogP | 3.81 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|