C23H37N5O5 — CID 145423765
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-(cyclobutylmethyl)carbamate;formic acid (PubChem CID 145423765) has the molecular formula C23H37N5O5 and a molecular weight of 463.58 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-(cyclobutylmethyl)carbamate;formic acid.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-(cyclobutylmethyl)carbamate;formic acid |
|---|---|
| PubChem CID | 145423765 |
| Molecular Formula | C23H37N5O5 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-(cyclobutylmethyl)carbamate;formic acid |
| SMILES | Cc1nc(/C(N)=C(\COC(=O)NCC2CCC2)N(C)N)ccc1OC1CCCCC1.O=CO |
| InChI | InChI=1S/C22H35N5O3.CH2O2/c1-15-20(30-17-9-4-3-5-10-17)12-11-18(26-15)21(23)19(27(2)24)14-29-22(28)25-13-16-7-6-8-16;2-1-3/h11-12,16-17H,3-10,13-14,23-24H2,1-2H3,(H,25,28);1H,(H,2,3)/b21-19-; |
| InChIKey | ASRCGDKNDNPXCC-WQGAEACMSA-N |
| XLogP | 2.76 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|