C24H37N5O3 — CID 154936285
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3-cyclopropylpyrrolidine-1-carboxylate (PubChem CID 154936285) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3-cyclopropylpyrrolidine-1-carboxylate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3-cyclopropylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 154936285 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3-cyclopropylpyrrolidine-1-carboxylate |
| SMILES | Cc1nc(/C(N)=C(\COC(=O)N2CCC(C3CC3)C2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C24H37N5O3/c1-16-22(32-19-6-4-3-5-7-19)11-10-20(27-16)23(25)21(28(2)26)15-31-24(30)29-13-12-18(14-29)17-8-9-17/h10-11,17-19H,3-9,12-15,25-26H2,1-2H3/b23-21- |
| InChIKey | NOGIVFSUTFXPLN-LNVKXUELSA-N |
| XLogP | 3.40 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|