C24H39N5O3 — CID 154935997
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3,3-dimethylpiperidine-1-carboxylate (PubChem CID 154935997) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 154935997 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] 3,3-dimethylpiperidine-1-carboxylate |
| SMILES | Cc1nc(/C(N)=C(\COC(=O)N2CCCC(C)(C)C2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C24H39N5O3/c1-17-21(32-18-9-6-5-7-10-18)12-11-19(27-17)22(25)20(28(4)26)15-31-23(30)29-14-8-13-24(2,3)16-29/h11-12,18H,5-10,13-16,25-26H2,1-4H3/b22-20- |
| InChIKey | OMXOAYPTMYTBOQ-XDOYNYLZSA-N |
| XLogP | 3.79 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|