C21H35N5O4 — CID 166804132
3-methoxypropyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 166804132) has the molecular formula C21H35N5O4 and a molecular weight of 421.54 g/mol. Its IUPAC name is 3-methoxypropyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | 3-methoxypropyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166804132 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 3-methoxypropyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | COCCCOC(=O)NC/C(=C(/N)c1ccc(OC2CCCCC2)c(C)n1)N(C)N |
| InChI | InChI=1S/C21H35N5O4/c1-15-19(30-16-8-5-4-6-9-16)11-10-17(25-15)20(22)18(26(2)23)14-24-21(27)29-13-7-12-28-3/h10-11,16H,4-9,12-14,22-23H2,1-3H3,(H,24,27)/b20-18- |
| InChIKey | MEFFNGKHPZCDTB-ZZEZOPTASA-N |
| XLogP | 2.30 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|