C20H32N8O3 — CID 167298502
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[5-(2-methoxyethoxy)tetrazol-2-yl]prop-1-en-1-amine (PubChem CID 167298502) has the molecular formula C20H32N8O3 and a molecular weight of 432.53 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[5-(2-methoxyethoxy)tetrazol-2-yl]prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[5-(2-methoxyethoxy)tetrazol-2-yl]prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298502 |
| Molecular Formula | C20H32N8O3 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-[5-(2-methoxyethoxy)tetrazol-2-yl]prop-1-en-1-amine |
| SMILES | COCCOc1nnn(C/C(=C(/N)c2ccc(OC3CCCCC3)c(C)n2)N(C)N)n1 |
| InChI | InChI=1S/C20H32N8O3/c1-14-18(31-15-7-5-4-6-8-15)10-9-16(23-14)19(21)17(27(2)22)13-28-25-20(24-26-28)30-12-11-29-3/h9-10,15H,4-8,11-13,21-22H2,1-3H3/b19-17- |
| InChIKey | AWZVCVIFKPGPPL-ZPHPHTNESA-N |
| XLogP | 1.25 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|