C21H31N7O — CID 167298670
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(5-cyclopropyltriazol-1-yl)prop-1-en-1-amine (PubChem CID 167298670) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(5-cyclopropyltriazol-1-yl)prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(5-cyclopropyltriazol-1-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298670 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(5-cyclopropyltriazol-1-yl)prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\Cn2nncc2C2CC2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C21H31N7O/c1-14-20(29-16-6-4-3-5-7-16)11-10-17(25-14)21(22)19(27(2)23)13-28-18(12-24-26-28)15-8-9-15/h10-12,15-16H,3-9,13,22-23H2,1-2H3/b21-19- |
| InChIKey | MNEUSFCYUFEQEQ-VZCXRCSSSA-N |
| XLogP | 2.70 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|