C22H36N8O — CID 167298547
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[2-(2-methylpropyl)triazol-4-yl]prop-1-ene-1,3-diamine (PubChem CID 167298547) has the molecular formula C22H36N8O and a molecular weight of 428.59 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[2-(2-methylpropyl)triazol-4-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[2-(2-methylpropyl)triazol-4-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298547 |
| Molecular Formula | C22H36N8O |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[2-(2-methylpropyl)triazol-4-yl]prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2cnn(CC(C)C)n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C22H36N8O/c1-15(2)14-30-26-13-21(28-30)25-12-19(29(4)24)22(23)18-10-11-20(16(3)27-18)31-17-8-6-5-7-9-17/h10-11,13,15,17H,5-9,12,14,23-24H2,1-4H3,(H,25,28)/b22-19- |
| InChIKey | WPSWQWSERSLSKW-QOCHGBHMSA-N |
| XLogP | 2.89 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|