C23H30ClN9O — CID 167298674
(Z)-2-[amino(methyl)amino]-N'-[2-(4-chlorophenyl)tetrazol-5-yl]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine (PubChem CID 167298674) has the molecular formula C23H30ClN9O and a molecular weight of 484.01 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-N'-[2-(4-chlorophenyl)tetrazol-5-yl]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-N'-[2-(4-chlorophenyl)tetrazol-5-yl]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298674 |
| Molecular Formula | C23H30ClN9O |
| Molecular Weight | 484.01 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-N'-[2-(4-chlorophenyl)tetrazol-5-yl]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2nnn(-c3ccc(Cl)cc3)n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H30ClN9O/c1-15-21(34-18-6-4-3-5-7-18)13-12-19(28-15)22(25)20(32(2)26)14-27-23-29-31-33(30-23)17-10-8-16(24)9-11-17/h8-13,18H,3-7,14,25-26H2,1-2H3,(H,27,30)/b22-20- |
| InChIKey | VGMLUCRAQQWSMB-XDOYNYLZSA-N |
| XLogP | 3.28 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.01 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|