C23H34N8O — CID 167262674
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[4-(1-methylcyclopropyl)-1,3,5-triazin-2-yl]prop-1-ene-1,3-diamine (PubChem CID 167262674) has the molecular formula C23H34N8O and a molecular weight of 438.58 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[4-(1-methylcyclopropyl)-1,3,5-triazin-2-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[4-(1-methylcyclopropyl)-1,3,5-triazin-2-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167262674 |
| Molecular Formula | C23H34N8O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[4-(1-methylcyclopropyl)-1,3,5-triazin-2-yl]prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2ncnc(C3(C)CC3)n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H34N8O/c1-15-19(32-16-7-5-4-6-8-16)10-9-17(29-15)20(24)18(31(3)25)13-26-22-28-14-27-21(30-22)23(2)11-12-23/h9-10,14,16H,4-8,11-13,24-25H2,1-3H3,(H,26,27,28,30)/b20-18- |
| InChIKey | HWKYGUWEFYIHTF-ZZEZOPTASA-N |
| XLogP | 2.88 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|