C24H33N9O — CID 167298501
(Z)-2-[amino(methyl)amino]-N'-(2-benzyltetrazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine (PubChem CID 167298501) has the molecular formula C24H33N9O and a molecular weight of 463.59 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-N'-(2-benzyltetrazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-N'-(2-benzyltetrazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298501 |
| Molecular Formula | C24H33N9O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-N'-(2-benzyltetrazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2nnn(Cc3ccccc3)n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C24H33N9O/c1-17-22(34-19-11-7-4-8-12-19)14-13-20(28-17)23(25)21(32(2)26)15-27-24-29-31-33(30-24)16-18-9-5-3-6-10-18/h3,5-6,9-10,13-14,19H,4,7-8,11-12,15-16,25-26H2,1-2H3,(H,27,30)/b23-21- |
| InChIKey | PGTOTQPDLMCXHK-LNVKXUELSA-N |
| XLogP | 2.68 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|