C26H38N6O2 — CID 166804406
3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-[(1S)-1-phenylethyl]urea (PubChem CID 166804406) has the molecular formula C26H38N6O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-[(1S)-1-phenylethyl]urea.
| Compound Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-[(1S)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 166804406 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-[(1S)-1-phenylethyl]urea |
| SMILES | Cc1nc(/C(N)=C(\CNC(=O)N(C)[C@@H](C)c2ccccc2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C26H38N6O2/c1-18-24(34-21-13-9-6-10-14-21)16-15-22(30-18)25(27)23(32(4)28)17-29-26(33)31(3)19(2)20-11-7-5-8-12-20/h5,7-8,11-12,15-16,19,21H,6,9-10,13-14,17,27-28H2,1-4H3,(H,29,33)/b25-23-/t19-/m0/s1 |
| InChIKey | VPKVOBADSUAFNO-VWOFGYOZSA-N |
| XLogP | 3.94 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|