C21H36N6O2 — CID 166804318
1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-3-(2-methylpropyl)urea (PubChem CID 166804318) has the molecular formula C21H36N6O2 and a molecular weight of 404.56 g/mol. Its IUPAC name is 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 166804318 |
| Molecular Formula | C21H36N6O2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 1-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-3-(2-methylpropyl)urea |
| SMILES | Cc1nc(/C(N)=C(\CNC(=O)NCC(C)C)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C21H36N6O2/c1-14(2)12-24-21(28)25-13-18(27(4)23)20(22)17-10-11-19(15(3)26-17)29-16-8-6-5-7-9-16/h10-11,14,16H,5-9,12-13,22-23H2,1-4H3,(H2,24,25,28)/b20-18- |
| InChIKey | LNZDJSWUGBAMNJ-ZZEZOPTASA-N |
| XLogP | 2.49 |
| TPSA | 118.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|