C22H35N7OS — CID 167298433
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]prop-1-ene-1,3-diamine (PubChem CID 167298433) has the molecular formula C22H35N7OS and a molecular weight of 445.64 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298433 |
| Molecular Formula | C22H35N7OS |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2nc(CC(C)C)ns2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C22H35N7OS/c1-14(2)12-20-27-22(31-28-20)25-13-18(29(4)24)21(23)17-10-11-19(15(3)26-17)30-16-8-6-5-7-9-16/h10-11,14,16H,5-9,12-13,23-24H2,1-4H3,(H,25,27,28)/b21-18- |
| InChIKey | YYUVDFHOFUPNOO-UZYVYHOESA-N |
| XLogP | 3.70 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|