C18H30N4O2 — CID 154936315
(Z)-5-amino-4-[amino(methyl)amino]-5-(5-cyclohexyloxy-6-methyl-2-pyridinyl)pent-4-en-1-ol (PubChem CID 154936315) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (Z)-5-amino-4-[amino(methyl)amino]-5-(5-cyclohexyloxy-6-methyl-2-pyridinyl)pent-4-en-1-ol.
| Compound Name | (Z)-5-amino-4-[amino(methyl)amino]-5-(5-cyclohexyloxy-6-methyl-2-pyridinyl)pent-4-en-1-ol |
|---|---|
| PubChem CID | 154936315 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (Z)-5-amino-4-[amino(methyl)amino]-5-(5-cyclohexyloxy-6-methyl-2-pyridinyl)pent-4-en-1-ol |
| SMILES | Cc1nc(/C(N)=C(\CCCO)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C18H30N4O2/c1-13-17(24-14-7-4-3-5-8-14)11-10-15(21-13)18(19)16(22(2)20)9-6-12-23/h10-11,14,23H,3-9,12,19-20H2,1-2H3/b18-16- |
| InChIKey | AMRMKQYGPNEUEW-VLGSPTGOSA-N |
| XLogP | 2.31 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|