C22H41N9O — CID 167298913
2-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]-1-butyl-1-methylguanidine (PubChem CID 167298913) has the molecular formula C22H41N9O and a molecular weight of 447.63 g/mol. Its IUPAC name is 2-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]-1-butyl-1-methylguanidine.
| Compound Name | 2-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]-1-butyl-1-methylguanidine |
|---|---|
| PubChem CID | 167298913 |
| Molecular Formula | C22H41N9O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.34 |
| IUPAC Name | 2-[amino-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]amino]-1-butyl-1-methylguanidine |
| SMILES | CCCCN(C)/C(N)=N/N(N)C/C(=C(/N)c1ccc(OC2CCCCC2)c(C)n1)N(C)N |
| InChI | InChI=1S/C22H41N9O/c1-5-6-14-29(3)22(24)28-31(26)15-19(30(4)25)21(23)18-12-13-20(16(2)27-18)32-17-10-8-7-9-11-17/h12-13,17H,5-11,14-15,23,25-26H2,1-4H3,(H2,24,28)/b21-19- |
| InChIKey | ORIKMYMRMJOJAU-VZCXRCSSSA-N |
| XLogP | 1.67 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|