C17H26N8O — CID 167298819
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(2H-tetrazol-5-yl)prop-1-en-1-amine (PubChem CID 167298819) has the molecular formula C17H26N8O and a molecular weight of 358.45 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(2H-tetrazol-5-yl)prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(2H-tetrazol-5-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298819 |
| Molecular Formula | C17H26N8O |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-3-(2H-tetrazol-5-yl)prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\Cc2nn[nH]n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C17H26N8O/c1-11-15(26-12-6-4-3-5-7-12)9-8-13(20-11)17(18)14(25(2)19)10-16-21-23-24-22-16/h8-9,12H,3-7,10,18-19H2,1-2H3,(H,21,22,23,24)/b17-14- |
| InChIKey | AFXFSXLHMFITEW-VKAVYKQESA-N |
| XLogP | 1.29 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|