C25H32N6O2 — CID 167298658
(Z)-2-[amino(methyl)amino]-3-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine (PubChem CID 167298658) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-3-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine.
| Compound Name | (Z)-2-[amino(methyl)amino]-3-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 167298658 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-3-(3-benzyl-1,2,4-oxadiazol-5-yl)-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-1-en-1-amine |
| SMILES | Cc1nc(/C(N)=C(\Cc2nc(Cc3ccccc3)no2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C25H32N6O2/c1-17-22(32-19-11-7-4-8-12-19)14-13-20(28-17)25(26)21(31(2)27)16-24-29-23(30-33-24)15-18-9-5-3-6-10-18/h3,5-6,9-10,13-14,19H,4,7-8,11-12,15-16,26-27H2,1-2H3/b25-21- |
| InChIKey | HAENHMCCBGIHKT-DAFNUICNSA-N |
| XLogP | 3.75 |
| TPSA | 116.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|