C21H33N7O2 — CID 167298312
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)prop-1-ene-1,3-diamine (PubChem CID 167298312) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298312 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2nc(C(C)C)no2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C21H33N7O2/c1-13(2)20-26-21(30-27-20)24-12-17(28(4)23)19(22)16-10-11-18(14(3)25-16)29-15-8-6-5-7-9-15/h10-11,13,15H,5-9,12,22-23H2,1-4H3,(H,24,26,27)/b19-17- |
| InChIKey | NCIGOGHBLIBJPE-ZPHPHTNESA-N |
| XLogP | 3.15 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|