C23H37N7O3 — CID 167298601
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(1-propoxyethyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine (PubChem CID 167298601) has the molecular formula C23H37N7O3 and a molecular weight of 459.60 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(1-propoxyethyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(1-propoxyethyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298601 |
| Molecular Formula | C23H37N7O3 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(1-propoxyethyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine |
| SMILES | CCCOC(C)c1nc(NC/C(=C(/N)c2ccc(OC3CCCCC3)c(C)n2)N(C)N)no1 |
| InChI | InChI=1S/C23H37N7O3/c1-5-13-31-16(3)22-28-23(29-33-22)26-14-19(30(4)25)21(24)18-11-12-20(15(2)27-18)32-17-9-7-6-8-10-17/h11-12,16-17H,5-10,13-14,24-25H2,1-4H3,(H,26,29)/b21-19- |
| InChIKey | XELFVELCXVAYJZ-VZCXRCSSSA-N |
| XLogP | 3.52 |
| TPSA | 137.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|