C23H35N7O2 — CID 167298869
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pent-4-en-2-yl-1,2,4-oxadiazol-3-yl)prop-1-ene-1,3-diamine (PubChem CID 167298869) has the molecular formula C23H35N7O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pent-4-en-2-yl-1,2,4-oxadiazol-3-yl)prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pent-4-en-2-yl-1,2,4-oxadiazol-3-yl)prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298869 |
| Molecular Formula | C23H35N7O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-(5-pent-4-en-2-yl-1,2,4-oxadiazol-3-yl)prop-1-ene-1,3-diamine |
| SMILES | C=CCC(C)c1nc(NC/C(=C(/N)c2ccc(OC3CCCCC3)c(C)n2)N(C)N)no1 |
| InChI | InChI=1S/C23H35N7O2/c1-5-9-15(2)22-28-23(29-32-22)26-14-19(30(4)25)21(24)18-12-13-20(16(3)27-18)31-17-10-7-6-8-11-17/h5,12-13,15,17H,1,6-11,14,24-25H2,2-4H3,(H,26,29)/b21-19- |
| InChIKey | DURPQXNJNJMWPW-VZCXRCSSSA-N |
| XLogP | 3.71 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|