C22H32F3N7O2 — CID 167298560
(Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(4,4,4-trifluorobutyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine (PubChem CID 167298560) has the molecular formula C22H32F3N7O2 and a molecular weight of 483.54 g/mol. Its IUPAC name is (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(4,4,4-trifluorobutyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine.
| Compound Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(4,4,4-trifluorobutyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 167298560 |
| Molecular Formula | C22H32F3N7O2 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | (Z)-2-[amino(methyl)amino]-1-(5-cyclohexyloxy-6-methyl-2-pyridinyl)-N'-[5-(4,4,4-trifluorobutyl)-1,2,4-oxadiazol-3-yl]prop-1-ene-1,3-diamine |
| SMILES | Cc1nc(/C(N)=C(\CNc2noc(CCCC(F)(F)F)n2)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C22H32F3N7O2/c1-14-18(33-15-7-4-3-5-8-15)11-10-16(29-14)20(26)17(32(2)27)13-28-21-30-19(34-31-21)9-6-12-22(23,24)25/h10-11,15H,3-9,12-13,26-27H2,1-2H3,(H,28,31)/b20-17- |
| InChIKey | XTHHPYLSDQGQFI-JZJYNLBNSA-N |
| XLogP | 3.91 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|