C23H40N6O2 — CID 166804321
3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-(3-methylbutan-2-yl)urea (PubChem CID 166804321) has the molecular formula C23H40N6O2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-(3-methylbutan-2-yl)urea.
| Compound Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-(3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 166804321 |
| Molecular Formula | C23H40N6O2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 3-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl]-1-methyl-1-(3-methylbutan-2-yl)urea |
| SMILES | Cc1nc(/C(N)=C(\CNC(=O)N(C)C(C)C(C)C)N(C)N)ccc1OC1CCCCC1 |
| InChI | InChI=1S/C23H40N6O2/c1-15(2)17(4)28(5)23(30)26-14-20(29(6)25)22(24)19-12-13-21(16(3)27-19)31-18-10-8-7-9-11-18/h12-13,15,17-18H,7-11,14,24-25H2,1-6H3,(H,26,30)/b22-20- |
| InChIKey | KPRVHTLRHVXXFS-XDOYNYLZSA-N |
| XLogP | 3.22 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|