C23H39N5O3 — CID 154936261
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-methyl-N-pentan-2-ylcarbamate (PubChem CID 154936261) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-methyl-N-pentan-2-ylcarbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-methyl-N-pentan-2-ylcarbamate |
|---|---|
| PubChem CID | 154936261 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methyl-2-pyridinyl)prop-2-enyl] N-methyl-N-pentan-2-ylcarbamate |
| SMILES | CCCC(C)N(C)C(=O)OC/C(=C(/N)c1ccc(OC2CCCCC2)c(C)n1)N(C)N |
| InChI | InChI=1S/C23H39N5O3/c1-6-10-16(2)27(4)23(29)30-15-20(28(5)25)22(24)19-13-14-21(17(3)26-19)31-18-11-8-7-9-12-18/h13-14,16,18H,6-12,15,24-25H2,1-5H3/b22-20- |
| InChIKey | CXAAXFZKJLEXJL-XDOYNYLZSA-N |
| XLogP | 3.79 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|