C21H35N5O4 — CID 154936338
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methoxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate (PubChem CID 154936338) has the molecular formula C21H35N5O4 and a molecular weight of 421.54 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methoxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methoxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate |
|---|---|
| PubChem CID | 154936338 |
| Molecular Formula | C21H35N5O4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-6-methoxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate |
| SMILES | CCCN(C)C(=O)OC/C(=C(/N)c1ccc(OC2CCCCC2)c(OC)n1)N(C)N |
| InChI | InChI=1S/C21H35N5O4/c1-5-13-25(2)21(27)29-14-17(26(3)23)19(22)16-11-12-18(20(24-16)28-4)30-15-9-7-6-8-10-15/h11-12,15H,5-10,13-14,22-23H2,1-4H3/b19-17- |
| InChIKey | HUIIZVKGBHQBSR-ZPHPHTNESA-N |
| XLogP | 2.71 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|