C21H32N6O3 — CID 145423803
[(Z)-3-amino-2-[amino(methyl)amino]-3-(6-cyano-5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate (PubChem CID 145423803) has the molecular formula C21H32N6O3 and a molecular weight of 416.53 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(6-cyano-5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(6-cyano-5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate |
|---|---|
| PubChem CID | 145423803 |
| Molecular Formula | C21H32N6O3 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(6-cyano-5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-propylcarbamate |
| SMILES | CCCN(C)C(=O)OC/C(=C(/N)c1ccc(OC2CCCCC2)c(C#N)n1)N(C)N |
| InChI | InChI=1S/C21H32N6O3/c1-4-12-26(2)21(28)29-14-18(27(3)24)20(23)16-10-11-19(17(13-22)25-16)30-15-8-6-5-7-9-15/h10-11,15H,4-9,12,14,23-24H2,1-3H3/b20-18- |
| InChIKey | KEJXJWNAVMVOID-ZZEZOPTASA-N |
| XLogP | 2.58 |
| TPSA | 130.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|