C22H37N5O3 — CID 154935949
[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-(3-methylbutyl)carbamate (PubChem CID 154935949) has the molecular formula C22H37N5O3 and a molecular weight of 419.57 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-(3-methylbutyl)carbamate.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-(3-methylbutyl)carbamate |
|---|---|
| PubChem CID | 154935949 |
| Molecular Formula | C22H37N5O3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl] N-methyl-N-(3-methylbutyl)carbamate |
| SMILES | CC(C)CCN(C)C(=O)OC/C(=C(/N)c1ccc(OC2CCCCC2)cn1)N(C)N |
| InChI | InChI=1S/C22H37N5O3/c1-16(2)12-13-26(3)22(28)29-15-20(27(4)24)21(23)19-11-10-18(14-25-19)30-17-8-6-5-7-9-17/h10-11,14,16-17H,5-9,12-13,15,23-24H2,1-4H3/b21-20- |
| InChIKey | BGALSCLPEXKBPB-MRCUWXFGSA-N |
| XLogP | 3.34 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|