C21H36N8O — CID 167298903
N,N'-diamino-N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]cyclopentanecarboximidamide (PubChem CID 167298903) has the molecular formula C21H36N8O and a molecular weight of 416.57 g/mol. Its IUPAC name is N,N'-diamino-N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]cyclopentanecarboximidamide.
| Compound Name | N,N'-diamino-N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 167298903 |
| Molecular Formula | C21H36N8O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | N,N'-diamino-N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]cyclopentanecarboximidamide |
| SMILES | CN(N)/C(CN(N)/C(=N\N)C1CCCC1)=C(\N)c1ccc(OC2CCCCC2)cn1 |
| InChI | InChI=1S/C21H36N8O/c1-28(24)19(14-29(25)21(27-23)15-7-5-6-8-15)20(22)18-12-11-17(13-26-18)30-16-9-3-2-4-10-16/h11-13,15-16H,2-10,14,22-25H2,1H3/b20-19-,27-21- |
| InChIKey | JZPDLKWKCWRJPF-DTBFZVKYSA-N |
| XLogP | 1.86 |
| TPSA | 145.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|