C22H34N4O2 — CID 155007816
N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(4-cyclohexyloxyphenyl)prop-2-enyl]cyclopentanecarboxamide (PubChem CID 155007816) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(4-cyclohexyloxyphenyl)prop-2-enyl]cyclopentanecarboxamide.
| Compound Name | N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(4-cyclohexyloxyphenyl)prop-2-enyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 155007816 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(4-cyclohexyloxyphenyl)prop-2-enyl]cyclopentanecarboxamide |
| SMILES | CN(N)/C(CNC(=O)C1CCCC1)=C(\N)c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H34N4O2/c1-26(24)20(15-25-22(27)17-7-5-6-8-17)21(23)16-11-13-19(14-12-16)28-18-9-3-2-4-10-18/h11-14,17-18H,2-10,15,23-24H2,1H3,(H,25,27)/b21-20- |
| InChIKey | VIYSIJHBNDRQKT-MRCUWXFGSA-N |
| XLogP | 3.14 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|