C23H30FN5O3 — CID 166804221
(3-fluorophenyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate (PubChem CID 166804221) has the molecular formula C23H30FN5O3 and a molecular weight of 443.52 g/mol. Its IUPAC name is (3-fluorophenyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate.
| Compound Name | (3-fluorophenyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 166804221 |
| Molecular Formula | C23H30FN5O3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (3-fluorophenyl)methyl N-[(Z)-3-amino-2-[amino(methyl)amino]-3-(5-cyclohexyloxy-2-pyridinyl)prop-2-enyl]carbamate |
| SMILES | CN(N)/C(CNC(=O)OCc1cccc(F)c1)=C(\N)c1ccc(OC2CCCCC2)cn1 |
| InChI | InChI=1S/C23H30FN5O3/c1-29(26)21(14-28-23(30)31-15-16-6-5-7-17(24)12-16)22(25)20-11-10-19(13-27-20)32-18-8-3-2-4-9-18/h5-7,10-13,18H,2-4,8-9,14-15,25-26H2,1H3,(H,28,30)/b22-21- |
| InChIKey | HTMWJDFLHMNBPJ-DQRAZIAOSA-N |
| XLogP | 3.29 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|