C25H38F3N5O3 — CID 145423869
[(Z)-3-amino-2-[amino(methyl)amino]-3-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl] N-cyclopentyl-N-methylcarbamate;ethene (PubChem CID 145423869) has the molecular formula C25H38F3N5O3 and a molecular weight of 513.61 g/mol. Its IUPAC name is [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl] N-cyclopentyl-N-methylcarbamate;ethene.
| Compound Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl] N-cyclopentyl-N-methylcarbamate;ethene |
|---|---|
| PubChem CID | 145423869 |
| Molecular Formula | C25H38F3N5O3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | [(Z)-3-amino-2-[amino(methyl)amino]-3-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]prop-2-enyl] N-cyclopentyl-N-methylcarbamate;ethene |
| SMILES | C=C.CN(N)/C(COC(=O)N(C)C1CCCC1)=C(\N)c1ccc(OC2CCCCC2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C23H34F3N5O3.C2H4/c1-30(15-8-6-7-9-15)22(32)33-14-18(31(2)28)20(27)17-12-13-19(21(29-17)23(24,25)26)34-16-10-4-3-5-11-16;1-2/h12-13,15-16H,3-11,14,27-28H2,1-2H3;1-2H2/b20-18-; |
| InChIKey | DWNGGAIJLYNSME-GQQUDWLYSA-N |
| XLogP | 5.06 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|