C24H36F3N5O3 — CID 155007640
N-[(Z)-4-amino-3-[amino(methyl)amino]-4-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]-2-methoxybut-3-enyl]-N-cyclopentylformamide (PubChem CID 155007640) has the molecular formula C24H36F3N5O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is N-[(Z)-4-amino-3-[amino(methyl)amino]-4-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]-2-methoxybut-3-enyl]-N-cyclopentylformamide.
| Compound Name | N-[(Z)-4-amino-3-[amino(methyl)amino]-4-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]-2-methoxybut-3-enyl]-N-cyclopentylformamide |
|---|---|
| PubChem CID | 155007640 |
| Molecular Formula | C24H36F3N5O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | N-[(Z)-4-amino-3-[amino(methyl)amino]-4-[5-cyclohexyloxy-6-(trifluoromethyl)-2-pyridinyl]-2-methoxybut-3-enyl]-N-cyclopentylformamide |
| SMILES | COC(CN(C=O)C1CCCC1)/C(=C(/N)c1ccc(OC2CCCCC2)c(C(F)(F)F)n1)N(C)N |
| InChI | InChI=1S/C24H36F3N5O3/c1-31(29)22(20(34-2)14-32(15-33)16-8-6-7-9-16)21(28)18-12-13-19(23(30-18)24(25,26)27)35-17-10-4-3-5-11-17/h12-13,15-17,20H,3-11,14,28-29H2,1-2H3/b22-21- |
| InChIKey | SGAAKBAUTGVMHU-DQRAZIAOSA-N |
| XLogP | 3.66 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|